Peak
number |
Compound
identification |
---|---|
1 | n-C27 alkane |
2 |
5![]() ![]() ![]() |
3 | cholest-4-ene |
4 |
5![]() ![]() ![]() |
5 |
C2717![]() |
6 |
20R-5![]() ![]() ![]() |
7 |
C2717![]() |
8 |
20R-5![]() ![]() ![]() |
9 | 30-norneohop-13(18)-ene |
10 | 24-ethyl-cholestadiene |
11 |
20R-5![]() ![]() ![]() |
12 | 24-ethylcholest-4-ene |
13 |
20R-5![]() ![]() ![]() |
14 | hop-17(21)-ene |
15 | n-C31 alkane |
16 | methyl-C30-sterane and methyl-C30-sterene |
17 |
17![]() ![]() |
18 |
17![]() ![]() |
19 | Unidentified hopene |
20 | C31-22S-homohop-17(21)-ene |
21 | C31-22R-homohop-17(21)-ene |
22 | n-C32 alkane |
23 |
C31-17![]() ![]() |
24 |
C30-17![]() ![]() |
25 |
C31-17![]() ![]() |
26 | n-C33 alkane |
27 |
C32-17![]() ![]() |
28 | Unidentified hopene |
29 |
C32-17![]() ![]() |
30 |
C31-17![]() ![]() |
31 |
C33-17![]() ![]() |
32 |
C33-17![]() ![]() |
33 |
C32-17![]() ![]() |
34 | Lycopane and n-C35 alkane |
35 | C35-homohop-17(21)-ene |
36 |
C33-17![]() ![]() |
37 |
C35-17![]() ![]() |
38 |
C34-17![]() ![]() |
Note: TIC from Sample 207-1258B-55R-1, 49–50 cm, shown in Figure F2.